C21H21N3O2 — CID 143969078
1-[5-(1-methylindol-5-yl)-1,3-benzoxazol-2-yl]piperidin-4-ol (PubChem CID 143969078) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[5-(1-methylindol-5-yl)-1,3-benzoxazol-2-yl]piperidin-4-ol.
| Compound Name | 1-[5-(1-methylindol-5-yl)-1,3-benzoxazol-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 143969078 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[5-(1-methylindol-5-yl)-1,3-benzoxazol-2-yl]piperidin-4-ol |
| SMILES | Cn1ccc2cc(-c3ccc4oc(N5CCC(O)CC5)nc4c3)ccc21 |
| InChI | InChI=1S/C21H21N3O2/c1-23-9-6-16-12-14(2-4-19(16)23)15-3-5-20-18(13-15)22-21(26-20)24-10-7-17(25)8-11-24/h2-6,9,12-13,17,25H,7-8,10-11H2,1H3 |
| InChIKey | VNPWXPOYWWSTMG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |