C36H51N7O2 — CID 143970932
N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[8-tert-butyl-2-(5-cyclopropyl-3-pyridinyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide (PubChem CID 143970932) has the molecular formula C36H51N7O2 and a molecular weight of 613.85 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[8-tert-butyl-2-(5-cyclopropyl-3-pyridinyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[8-tert-butyl-2-(5-cyclopropyl-3-pyridinyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide |
|---|---|
| PubChem CID | 143970932 |
| Molecular Formula | C36H51N7O2 |
| Molecular Weight | 613.85 g/mol |
| Exact Mass | 613.41 |
| IUPAC Name | N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[8-tert-butyl-2-(5-cyclopropyl-3-pyridinyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide |
| SMILES | CC(C)(C)CCC(c1ccc(C(=O)NC/C(N)=N/N)cc1)N1C(=O)C(c2cncc(C3CC3)c2)=NC12CCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C36H51N7O2/c1-34(2,3)16-15-29(24-9-11-25(12-10-24)32(44)40-22-30(37)42-38)43-33(45)31(27-19-26(20-39-21-27)23-7-8-23)41-36(43)17-13-28(14-18-36)35(4,5)6/h9-12,19-21,23,28-29H,7-8,13-18,22,38H2,1-6H3,(H2,37,42)(H,40,44) |
| InChIKey | SGSXPVQEYMBFIN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|