C35H47ClN6O2 — CID 88905439
N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[2-(3-chloro-5-methylphenyl)-8-(1-methylcyclopropyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide (PubChem CID 88905439) has the molecular formula C35H47ClN6O2 and a molecular weight of 619.25 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[2-(3-chloro-5-methylphenyl)-8-(1-methylcyclopropyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[2-(3-chloro-5-methylphenyl)-8-(1-methylcyclopropyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide |
|---|---|
| PubChem CID | 88905439 |
| Molecular Formula | C35H47ClN6O2 |
| Molecular Weight | 619.25 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[1-[2-(3-chloro-5-methylphenyl)-8-(1-methylcyclopropyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]benzamide |
| SMILES | Cc1cc(Cl)cc(C2=NC3(CCC(C4(C)CC4)CC3)N(C(CCC(C)(C)C)c3ccc(C(=O)NC/C(N)=N/N)cc3)C2=O)c1 |
| InChI | InChI=1S/C35H47ClN6O2/c1-22-18-25(20-27(36)19-22)30-32(44)42(35(40-30)14-10-26(11-15-35)34(5)16-17-34)28(12-13-33(2,3)4)23-6-8-24(9-7-23)31(43)39-21-29(37)41-38/h6-9,18-20,26,28H,10-17,21,38H2,1-5H3,(H2,37,41)(H,39,43) |
| InChIKey | VEDCCCJFLIQGNI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.25 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|