C36H47Cl2N3O4 — CID 158843334
3-[[4-[(1R)-1-[4'-(3,5-dichlorophenyl)-5'-oxospiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,2'-imidazole]-1'-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoic acid;methane (PubChem CID 158843334) has the molecular formula C36H47Cl2N3O4 and a molecular weight of 656.70 g/mol. Its IUPAC name is 3-[[4-[(1R)-1-[4'-(3,5-dichlorophenyl)-5'-oxospiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,2'-imidazole]-1'-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoic acid;methane.
| Compound Name | 3-[[4-[(1R)-1-[4'-(3,5-dichlorophenyl)-5'-oxospiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,2'-imidazole]-1'-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoic acid;methane |
|---|---|
| PubChem CID | 158843334 |
| Molecular Formula | C36H47Cl2N3O4 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | 3-[[4-[(1R)-1-[4'-(3,5-dichlorophenyl)-5'-oxospiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,2'-imidazole]-1'-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoic acid;methane |
| SMILES | C.CC(C)(C)CC[C@H](c1ccc(C(=O)NCCC(=O)O)cc1)N1C(=O)C(c2cc(Cl)cc(Cl)c2)=NC12CCC1CCCCC1C2 |
| InChI | InChI=1S/C35H43Cl2N3O4.CH4/c1-34(2,3)15-13-29(23-8-10-24(11-9-23)32(43)38-17-14-30(41)42)40-33(44)31(26-18-27(36)20-28(37)19-26)39-35(40)16-12-22-6-4-5-7-25(22)21-35;/h8-11,18-20,22,25,29H,4-7,12-17,21H2,1-3H3,(H,38,43)(H,41,42);1H4/t22?,25?,29-,35?;/m1./s1 |
| InChIKey | IYNGZSKXOSWXBV-CURDCQPJSA-N |
| XLogP | 8.72 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |