C33H45Cl2N7O2Si — CID 90334596
4-[(1R)-1-[2-(3,5-dichlorophenyl)-3-oxo-8-trimethylsilyl-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2,3-dihydro-1H-tetrazol-5-ylmethyl)benzamide (PubChem CID 90334596) has the molecular formula C33H45Cl2N7O2Si and a molecular weight of 670.76 g/mol. Its IUPAC name is 4-[(1R)-1-[2-(3,5-dichlorophenyl)-3-oxo-8-trimethylsilyl-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2,3-dihydro-1H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 4-[(1R)-1-[2-(3,5-dichlorophenyl)-3-oxo-8-trimethylsilyl-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2,3-dihydro-1H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 90334596 |
| Molecular Formula | C33H45Cl2N7O2Si |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | 4-[(1R)-1-[2-(3,5-dichlorophenyl)-3-oxo-8-trimethylsilyl-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2,3-dihydro-1H-tetrazol-5-ylmethyl)benzamide |
| SMILES | CC(C)(C)CC[C@H](c1ccc(C(=O)NCC2=NNNN2)cc1)N1C(=O)C(c2cc(Cl)cc(Cl)c2)=NC12CCC([Si](C)(C)C)CC2 |
| InChI | InChI=1S/C33H45Cl2N7O2Si/c1-32(2,3)14-13-27(21-7-9-22(10-8-21)30(43)36-20-28-38-40-41-39-28)42-31(44)29(23-17-24(34)19-25(35)18-23)37-33(42)15-11-26(12-16-33)45(4,5)6/h7-10,17-19,26-27,40-41H,11-16,20H2,1-6H3,(H,36,43)(H,38,39)/t26?,27-,33?/m1/s1 |
| InChIKey | HOPJZOODYKGFAS-ZIYYPANSSA-N |
| XLogP | 6.83 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|