C14H21N3O — CID 143973046
(2R,5S)-5-(4-aminobutyl)-2-benzylimidazolidin-4-one (PubChem CID 143973046) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is (2R,5S)-5-(4-aminobutyl)-2-benzylimidazolidin-4-one.
| Compound Name | (2R,5S)-5-(4-aminobutyl)-2-benzylimidazolidin-4-one |
|---|---|
| PubChem CID | 143973046 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (2R,5S)-5-(4-aminobutyl)-2-benzylimidazolidin-4-one |
| SMILES | NCCCC[C@@H]1N[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C14H21N3O/c15-9-5-4-8-12-14(18)17-13(16-12)10-11-6-2-1-3-7-11/h1-3,6-7,12-13,16H,4-5,8-10,15H2,(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | XTYNRDXBUZNVQO-QWHCGFSZSA-N |
| XLogP | 0.77 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|