C21H30N4O4 — CID 140510844
(4S,7R,12Z)-4-(4-aminobutyl)-7-benzyl-1-oxa-3,6,9-triazacyclotetradec-12-ene-2,5,8-trione (PubChem CID 140510844) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is (4S,7R,12Z)-4-(4-aminobutyl)-7-benzyl-1-oxa-3,6,9-triazacyclotetradec-12-ene-2,5,8-trione.
| Compound Name | (4S,7R,12Z)-4-(4-aminobutyl)-7-benzyl-1-oxa-3,6,9-triazacyclotetradec-12-ene-2,5,8-trione |
|---|---|
| PubChem CID | 140510844 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (4S,7R,12Z)-4-(4-aminobutyl)-7-benzyl-1-oxa-3,6,9-triazacyclotetradec-12-ene-2,5,8-trione |
| SMILES | NCCCC[C@@H]1NC(=O)OC/C=C\CCNC(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C21H30N4O4/c22-12-6-5-11-17-20(27)24-18(15-16-9-3-1-4-10-16)19(26)23-13-7-2-8-14-29-21(28)25-17/h1-4,8-10,17-18H,5-7,11-15,22H2,(H,23,26)(H,24,27)(H,25,28)/b8-2-/t17-,18+/m0/s1 |
| InChIKey | IUETXEMQWPMFQC-MYKMYRABSA-N |
| XLogP | 1.01 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|