C47H84O6 — CID 143974376
diethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane-4,5-dicarboxylate;ethane (PubChem CID 143974376) has the molecular formula C47H84O6 and a molecular weight of 745.18 g/mol. Its IUPAC name is diethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane-4,5-dicarboxylate;ethane.
| Compound Name | diethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane-4,5-dicarboxylate;ethane |
|---|---|
| PubChem CID | 143974376 |
| Molecular Formula | C47H84O6 |
| Molecular Weight | 745.18 g/mol |
| Exact Mass | 744.63 |
| IUPAC Name | diethyl 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane-4,5-dicarboxylate;ethane |
| SMILES | CC.CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC(C(=O)OCC)C(C(=O)OCC)O1 |
| InChI | InChI=1S/C45H78O6.C2H6/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-45(50-41(43(46)48-7-3)42(51-45)44(47)49-8-4)40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2;1-2/h15-18,21-24,41-42H,5-14,19-20,25-40H2,1-4H3;1-2H3/b17-15-,18-16-,23-21-,24-22-; |
| InChIKey | ZZLQPTDDHHZMOI-YIHZIEOQSA-N |
| XLogP | 14.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.18 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|