C27H34BrF3N4O2 — CID 143976287
ethane;methyl 1-[4-[(3-amino-6-bromoquinolin-4-yl)amino]-2-(trifluoromethyl)phenyl]piperidine-4-carboxylate (PubChem CID 143976287) has the molecular formula C27H34BrF3N4O2 and a molecular weight of 583.49 g/mol. Its IUPAC name is ethane;methyl 1-[4-[(3-amino-6-bromoquinolin-4-yl)amino]-2-(trifluoromethyl)phenyl]piperidine-4-carboxylate.
| Compound Name | ethane;methyl 1-[4-[(3-amino-6-bromoquinolin-4-yl)amino]-2-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 143976287 |
| Molecular Formula | C27H34BrF3N4O2 |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | ethane;methyl 1-[4-[(3-amino-6-bromoquinolin-4-yl)amino]-2-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
| SMILES | CC.CC.COC(=O)C1CCN(c2ccc(Nc3c(N)cnc4ccc(Br)cc34)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H22BrF3N4O2.2C2H6/c1-33-22(32)13-6-8-31(9-7-13)20-5-3-15(11-17(20)23(25,26)27)30-21-16-10-14(24)2-4-19(16)29-12-18(21)28;2*1-2/h2-5,10-13H,6-9,28H2,1H3,(H,29,30);2*1-2H3 |
| InChIKey | IEIZPCQESBEHPL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|