C36H39FN4O6 — CID 143976572
5-[3-[4-[2-fluoro-4-(methylamino)phenoxy]quinolin-7-yl]oxy-2-hydroxypropyl]-5-azaspiro[2.4]heptan-7-ol;1-formyl-N-phenylcyclopropane-1-carboxamide (PubChem CID 143976572) has the molecular formula C36H39FN4O6 and a molecular weight of 642.73 g/mol. Its IUPAC name is 5-[3-[4-[2-fluoro-4-(methylamino)phenoxy]quinolin-7-yl]oxy-2-hydroxypropyl]-5-azaspiro[2.4]heptan-7-ol;1-formyl-N-phenylcyclopropane-1-carboxamide.
| Compound Name | 5-[3-[4-[2-fluoro-4-(methylamino)phenoxy]quinolin-7-yl]oxy-2-hydroxypropyl]-5-azaspiro[2.4]heptan-7-ol;1-formyl-N-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143976572 |
| Molecular Formula | C36H39FN4O6 |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 5-[3-[4-[2-fluoro-4-(methylamino)phenoxy]quinolin-7-yl]oxy-2-hydroxypropyl]-5-azaspiro[2.4]heptan-7-ol;1-formyl-N-phenylcyclopropane-1-carboxamide |
| SMILES | CNc1ccc(Oc2ccnc3cc(OCC(O)CN4CC(O)C5(CC5)C4)ccc23)c(F)c1.O=CC1(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C25H28FN3O4.C11H11NO2/c1-27-16-2-5-23(20(26)10-16)33-22-6-9-28-21-11-18(3-4-19(21)22)32-14-17(30)12-29-13-24(31)25(15-29)7-8-25;13-8-11(6-7-11)10(14)12-9-4-2-1-3-5-9/h2-6,9-11,17,24,27,30-31H,7-8,12-15H2,1H3;1-5,8H,6-7H2,(H,12,14) |
| InChIKey | KYKGLTUCULXJSF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|