About 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide
2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide (PubChem CID 143980464) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide.
Molecular Properties
| Compound Name | 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide |
| PubChem CID | 143980464 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide |
| SMILES | CNC(=O)CCc1cccc(NC=O)c1.Cc1ccc(C)nc1 |
| InChI | InChI=1S/C11H14N2O2.C7H9N/c1-12-11(15)6-5-9-3-2-4-10(7-9)13-8-14;1-6-3-4-7(2)8-5-6/h2-4,7-8H,5-6H2,1H3,(H,12,15)(H,13,14);3-5H,1-2H3 |
| InChIKey | CGGCSLXSSKVERG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide?
The IUPAC name of 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide (CID 143980464) is 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide.
What is the SMILES notation for 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide?
The canonical SMILES for 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide is CNC(=O)CCc1cccc(NC=O)c1.Cc1ccc(C)nc1.
What is the InChIKey of 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide?
The InChIKey is CGGCSLXSSKVERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2.C7H9N/c1-12-11(15)6-5-9-3-2-4-10(7-9)13-8-14;1-6-3-4-7(2)8-5-6/h2-4,7-8H,5-6H2,1H3,(H,12,15)(H,13,14);3-5H,1-2H3.
What are the key properties of 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide?
2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide has a molecular weight of 313.40 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylpyridine;3-(3-formamidophenyl)-N-methylpropanamide is sourced from PubChem (CID 143980464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).