C20H24N4O3 — CID 143980458
2-but-2-ynoxy-5-methylpyrazine;3-(3-formamidophenyl)-N-methylpropanamide (PubChem CID 143980458) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-but-2-ynoxy-5-methylpyrazine;3-(3-formamidophenyl)-N-methylpropanamide.
| Compound Name | 2-but-2-ynoxy-5-methylpyrazine;3-(3-formamidophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 143980458 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-but-2-ynoxy-5-methylpyrazine;3-(3-formamidophenyl)-N-methylpropanamide |
| SMILES | CC#CCOc1cnc(C)cn1.CNC(=O)CCc1cccc(NC=O)c1 |
| InChI | InChI=1S/C11H14N2O2.C9H10N2O/c1-12-11(15)6-5-9-3-2-4-10(7-9)13-8-14;1-3-4-5-12-9-7-10-8(2)6-11-9/h2-4,7-8H,5-6H2,1H3,(H,12,15)(H,13,14);6-7H,5H2,1-2H3 |
| InChIKey | SYVRGRMVFOLTNO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|