C25H25N5O2S — CID 46931627
2-phenylethyl N'-[[3-[(5-but-2-ynoxypyrazine-2-carbonyl)amino]phenyl]methyl]carbamimidothioate (PubChem CID 46931627) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is 2-phenylethyl N'-[[3-[(5-but-2-ynoxypyrazine-2-carbonyl)amino]phenyl]methyl]carbamimidothioate.
| Compound Name | 2-phenylethyl N'-[[3-[(5-but-2-ynoxypyrazine-2-carbonyl)amino]phenyl]methyl]carbamimidothioate |
|---|---|
| PubChem CID | 46931627 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-phenylethyl N'-[[3-[(5-but-2-ynoxypyrazine-2-carbonyl)amino]phenyl]methyl]carbamimidothioate |
| SMILES | CC#CCOc1cnc(C(=O)Nc2cccc(C/N=C(/N)SCCc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C25H25N5O2S/c1-2-3-13-32-23-18-27-22(17-28-23)24(31)30-21-11-7-10-20(15-21)16-29-25(26)33-14-12-19-8-5-4-6-9-19/h4-11,15,17-18H,12-14,16H2,1H3,(H2,26,29)(H,30,31) |
| InChIKey | QUFBBLIQKVBHHJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|