C26H30FN5 — CID 143981207
ethene;8-fluoro-4-(piperidin-3-ylmethyl)quinoline;2-(2-methylphenyl)triazole (PubChem CID 143981207) has the molecular formula C26H30FN5 and a molecular weight of 431.56 g/mol. Its IUPAC name is ethene;8-fluoro-4-(piperidin-3-ylmethyl)quinoline;2-(2-methylphenyl)triazole.
| Compound Name | ethene;8-fluoro-4-(piperidin-3-ylmethyl)quinoline;2-(2-methylphenyl)triazole |
|---|---|
| PubChem CID | 143981207 |
| Molecular Formula | C26H30FN5 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | ethene;8-fluoro-4-(piperidin-3-ylmethyl)quinoline;2-(2-methylphenyl)triazole |
| SMILES | C=C.Cc1ccccc1-n1nccn1.Fc1cccc2c(CC3CCCNC3)ccnc12 |
| InChI | InChI=1S/C15H17FN2.C9H9N3.C2H4/c16-14-5-1-4-13-12(6-8-18-15(13)14)9-11-3-2-7-17-10-11;1-8-4-2-3-5-9(8)12-10-6-7-11-12;1-2/h1,4-6,8,11,17H,2-3,7,9-10H2;2-7H,1H3;1-2H2 |
| InChIKey | VTBZMDUACPXJFH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|