About 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide
4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 143981406) has the molecular formula C11H14FNO3
and a molecular weight of 227.23 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 143981406 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | O=CCNC(=O)C1C=CC(OCCF)=CC1 |
| InChI | InChI=1S/C11H14FNO3/c12-5-8-16-10-3-1-9(2-4-10)11(15)13-6-7-14/h1,3-4,7,9H,2,5-6,8H2,(H,13,15) |
| InChIKey | XBKKLNSJORSRRS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide (CID 143981406) is 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide is O=CCNC(=O)C1C=CC(OCCF)=CC1.
What is the InChIKey of 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide?
The InChIKey is XBKKLNSJORSRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO3/c12-5-8-16-10-3-1-9(2-4-10)11(15)13-6-7-14/h1,3-4,7,9H,2,5-6,8H2,(H,13,15).
What are the key properties of 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide?
4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide has a molecular weight of 227.23 g/mol, XLogP of 0.75, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethoxy)-N-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 143981406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).