C11H17NO2 — CID 155749588
N-[(3-ethoxycyclohexa-2,4-dien-1-yl)methyl]acetamide (PubChem CID 155749588) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(3-ethoxycyclohexa-2,4-dien-1-yl)methyl]acetamide.
| Compound Name | N-[(3-ethoxycyclohexa-2,4-dien-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 155749588 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(3-ethoxycyclohexa-2,4-dien-1-yl)methyl]acetamide |
| SMILES | CCOC1=CC(CNC(C)=O)CC=C1 |
| InChI | InChI=1S/C11H17NO2/c1-3-14-11-6-4-5-10(7-11)8-12-9(2)13/h4,6-7,10H,3,5,8H2,1-2H3,(H,12,13) |
| InChIKey | BJQZTBJGSHHDQP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |