C12H17N2O2P3 — CID 143981469
phosphanyl 2-[bis(phosphanyl)amino]-3-(6-methyl-1H-indol-3-yl)propanoate (PubChem CID 143981469) has the molecular formula C12H17N2O2P3 and a molecular weight of 314.20 g/mol. Its IUPAC name is phosphanyl 2-[bis(phosphanyl)amino]-3-(6-methyl-1H-indol-3-yl)propanoate.
| Compound Name | phosphanyl 2-[bis(phosphanyl)amino]-3-(6-methyl-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 143981469 |
| Molecular Formula | C12H17N2O2P3 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | phosphanyl 2-[bis(phosphanyl)amino]-3-(6-methyl-1H-indol-3-yl)propanoate |
| SMILES | Cc1ccc2c(CC(C(=O)OP)N(P)P)c[nH]c2c1 |
| InChI | InChI=1S/C12H17N2O2P3/c1-7-2-3-9-8(6-13-10(9)4-7)5-11(14(17)18)12(15)16-19/h2-4,6,11,13H,5,17-19H2,1H3 |
| InChIKey | KKJDXKWXTSQIFY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|