C42H35N — CID 143982100
14-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14-methyl-22-(4-methylcyclohexa-1,5-dien-1-yl)-22-phenyl-8-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,3,5,7,9,11,13(21),15(20),16,18-decaene (PubChem CID 143982100) has the molecular formula C42H35N and a molecular weight of 553.75 g/mol. Its IUPAC name is 14-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14-methyl-22-(4-methylcyclohexa-1,5-dien-1-yl)-22-phenyl-8-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,3,5,7,9,11,13(21),15(20),16,18-decaene.
| Compound Name | 14-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14-methyl-22-(4-methylcyclohexa-1,5-dien-1-yl)-22-phenyl-8-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,3,5,7,9,11,13(21),15(20),16,18-decaene |
|---|---|
| PubChem CID | 143982100 |
| Molecular Formula | C42H35N |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 14-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-14-methyl-22-(4-methylcyclohexa-1,5-dien-1-yl)-22-phenyl-8-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1,3,5,7,9,11,13(21),15(20),16,18-decaene |
| SMILES | C=C/C=C(\C=C/C)C1(C)c2cccc3c2-c2c4c1cccc4nc1cccc(c21)C3(C1=CCC(C)C=C1)c1ccccc1 |
| InChI | InChI=1S/C42H35N/c1-5-13-28(14-6-2)41(4)31-17-10-19-33-37(31)40-38-32(41)18-11-21-35(38)43-36-22-12-20-34(39(36)40)42(33,29-15-8-7-9-16-29)30-25-23-27(3)24-26-30/h5-23,25-27H,1,24H2,2-4H3/b14-6-,28-13+ |
| InChIKey | KPWJNHMFTDXJLY-HHCHABHLSA-N |
| XLogP | 10.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|