C24H29ClF2NO5PS — CID 143984995
2-(5-chloro-1-benzothiophen-3-yl)-N-[(E)-2-(3,4-difluorophenyl)ethenyl]-2-[methyl(methylperoxy)phosphoryl]acetamide;ethane;ethanol (PubChem CID 143984995) has the molecular formula C24H29ClF2NO5PS and a molecular weight of 547.99 g/mol. Its IUPAC name is 2-(5-chloro-1-benzothiophen-3-yl)-N-[(E)-2-(3,4-difluorophenyl)ethenyl]-2-[methyl(methylperoxy)phosphoryl]acetamide;ethane;ethanol.
| Compound Name | 2-(5-chloro-1-benzothiophen-3-yl)-N-[(E)-2-(3,4-difluorophenyl)ethenyl]-2-[methyl(methylperoxy)phosphoryl]acetamide;ethane;ethanol |
|---|---|
| PubChem CID | 143984995 |
| Molecular Formula | C24H29ClF2NO5PS |
| Molecular Weight | 547.99 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 2-(5-chloro-1-benzothiophen-3-yl)-N-[(E)-2-(3,4-difluorophenyl)ethenyl]-2-[methyl(methylperoxy)phosphoryl]acetamide;ethane;ethanol |
| SMILES | CC.CCO.COOP(C)(=O)C(C(=O)N/C=C/c1ccc(F)c(F)c1)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H17ClF2NO4PS.C2H6O.C2H6/c1-27-28-29(2,26)19(15-11-30-18-6-4-13(21)10-14(15)18)20(25)24-8-7-12-3-5-16(22)17(23)9-12;1-2-3;1-2/h3-11,19H,1-2H3,(H,24,25);3H,2H2,1H3;1-2H3/b8-7+;; |
| InChIKey | DVHGOZBYKIZZMK-MIIBGCIDSA-N |
| XLogP | 7.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.99 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|