C22H21ClFN2O6PS — CID 58085115
2-(5-chloro-1-benzothiophen-3-yl)-2-diethoxyphosphoryl-N-[(E)-2-(3-fluoro-4-nitrophenyl)ethenyl]acetamide (PubChem CID 58085115) has the molecular formula C22H21ClFN2O6PS and a molecular weight of 526.91 g/mol. Its IUPAC name is 2-(5-chloro-1-benzothiophen-3-yl)-2-diethoxyphosphoryl-N-[(E)-2-(3-fluoro-4-nitrophenyl)ethenyl]acetamide.
| Compound Name | 2-(5-chloro-1-benzothiophen-3-yl)-2-diethoxyphosphoryl-N-[(E)-2-(3-fluoro-4-nitrophenyl)ethenyl]acetamide |
|---|---|
| PubChem CID | 58085115 |
| Molecular Formula | C22H21ClFN2O6PS |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 2-(5-chloro-1-benzothiophen-3-yl)-2-diethoxyphosphoryl-N-[(E)-2-(3-fluoro-4-nitrophenyl)ethenyl]acetamide |
| SMILES | CCOP(=O)(OCC)C(C(=O)N/C=C/c1ccc([N+](=O)[O-])c(F)c1)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H21ClFN2O6PS/c1-3-31-33(30,32-4-2)21(17-13-34-20-8-6-15(23)12-16(17)20)22(27)25-10-9-14-5-7-19(26(28)29)18(24)11-14/h5-13,21H,3-4H2,1-2H3,(H,25,27)/b10-9+ |
| InChIKey | CHWCFJWKBIDRDD-MDZDMXLPSA-N |
| XLogP | 6.70 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|