C24H26ClO4PS — CID 58062097
(E)-1-(5-chloro-1-benzothiophen-3-yl)-1-diethoxyphosphoryl-5-(4-methylphenyl)pent-4-en-2-one (PubChem CID 58062097) has the molecular formula C24H26ClO4PS and a molecular weight of 476.96 g/mol. Its IUPAC name is (E)-1-(5-chloro-1-benzothiophen-3-yl)-1-diethoxyphosphoryl-5-(4-methylphenyl)pent-4-en-2-one.
| Compound Name | (E)-1-(5-chloro-1-benzothiophen-3-yl)-1-diethoxyphosphoryl-5-(4-methylphenyl)pent-4-en-2-one |
|---|---|
| PubChem CID | 58062097 |
| Molecular Formula | C24H26ClO4PS |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (E)-1-(5-chloro-1-benzothiophen-3-yl)-1-diethoxyphosphoryl-5-(4-methylphenyl)pent-4-en-2-one |
| SMILES | CCOP(=O)(OCC)C(C(=O)C/C=C/c1ccc(C)cc1)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H26ClO4PS/c1-4-28-30(27,29-5-2)24(21-16-31-23-14-13-19(25)15-20(21)23)22(26)8-6-7-18-11-9-17(3)10-12-18/h6-7,9-16,24H,4-5,8H2,1-3H3/b7-6+ |
| InChIKey | GRQKRQSWXQSICA-VOTSOKGWSA-N |
| XLogP | 7.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|