C12H12ClO3PS — CID 70335767
[1-(5-chloro-1-benzothiophen-3-yl)-2-oxopropyl]-methylphosphinic acid (PubChem CID 70335767) has the molecular formula C12H12ClO3PS and a molecular weight of 302.72 g/mol. Its IUPAC name is [1-(5-chloro-1-benzothiophen-3-yl)-2-oxopropyl]-methylphosphinic acid.
| Compound Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-oxopropyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 70335767 |
| Molecular Formula | C12H12ClO3PS |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-oxopropyl]-methylphosphinic acid |
| SMILES | CC(=O)C(c1csc2ccc(Cl)cc12)P(C)(=O)O |
| InChI | InChI=1S/C12H12ClO3PS/c1-7(14)12(17(2,15)16)10-6-18-11-4-3-8(13)5-9(10)11/h3-6,12H,1-2H3,(H,15,16) |
| InChIKey | ZGQDFRLEOVYSCD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|