C20H18ClO4PS — CID 58062106
[(E)-1-(5-chloro-1-benzothiophen-3-yl)-5-(2-hydroxyphenyl)-2-oxopent-4-enyl]-methylphosphinic acid (PubChem CID 58062106) has the molecular formula C20H18ClO4PS and a molecular weight of 420.85 g/mol. Its IUPAC name is [(E)-1-(5-chloro-1-benzothiophen-3-yl)-5-(2-hydroxyphenyl)-2-oxopent-4-enyl]-methylphosphinic acid.
| Compound Name | [(E)-1-(5-chloro-1-benzothiophen-3-yl)-5-(2-hydroxyphenyl)-2-oxopent-4-enyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 58062106 |
| Molecular Formula | C20H18ClO4PS |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | [(E)-1-(5-chloro-1-benzothiophen-3-yl)-5-(2-hydroxyphenyl)-2-oxopent-4-enyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)C(C(=O)C/C=C/c1ccccc1O)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H18ClO4PS/c1-26(24,25)20(16-12-27-19-10-9-14(21)11-15(16)19)18(23)8-4-6-13-5-2-3-7-17(13)22/h2-7,9-12,20,22H,8H2,1H3,(H,24,25)/b6-4+ |
| InChIKey | GVUFUNUBURFQLZ-GQCTYLIASA-N |
| XLogP | 5.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|