C18H26N2O2 — CID 143987049
(3S)-3-amino-1-phenylpyrrolidine-2,5-dione;(2S)-1,2-dimethylcyclohexane (PubChem CID 143987049) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (3S)-3-amino-1-phenylpyrrolidine-2,5-dione;(2S)-1,2-dimethylcyclohexane.
| Compound Name | (3S)-3-amino-1-phenylpyrrolidine-2,5-dione;(2S)-1,2-dimethylcyclohexane |
|---|---|
| PubChem CID | 143987049 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (3S)-3-amino-1-phenylpyrrolidine-2,5-dione;(2S)-1,2-dimethylcyclohexane |
| SMILES | CC1CCCC[C@@H]1C.N[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C10H10N2O2.C8H16/c11-8-6-9(13)12(10(8)14)7-4-2-1-3-5-7;1-7-5-3-4-6-8(7)2/h1-5,8H,6,11H2;7-8H,3-6H2,1-2H3/t8-;7-,8?/m00/s1 |
| InChIKey | JPJOUAPWQMVEIM-MBHQJZITSA-N |
| XLogP | 3.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|