C16H21N2O2+ — CID 4743964
cyclohexyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium (PubChem CID 4743964) has the molecular formula C16H21N2O2+ and a molecular weight of 273.36 g/mol. Its IUPAC name is cyclohexyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium.
| Compound Name | cyclohexyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium |
|---|---|
| PubChem CID | 4743964 |
| Molecular Formula | C16H21N2O2+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | cyclohexyl-(2,5-dioxo-1-phenylpyrrolidin-3-yl)azanium |
| SMILES | O=C1CC([NH2+]C2CCCCC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2/c19-15-11-14(17-12-7-3-1-4-8-12)16(20)18(15)13-9-5-2-6-10-13/h2,5-6,9-10,12,14,17H,1,3-4,7-8,11H2/p+1 |
| InChIKey | WPHZEODLJNHGHI-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|