C25H36N4O — CID 143988274
2,5-diamino-N-[3-phenyl-1-[1-(4-propan-2-ylphenyl)ethenylamino]propyl]pentanamide (PubChem CID 143988274) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is 2,5-diamino-N-[3-phenyl-1-[1-(4-propan-2-ylphenyl)ethenylamino]propyl]pentanamide.
| Compound Name | 2,5-diamino-N-[3-phenyl-1-[1-(4-propan-2-ylphenyl)ethenylamino]propyl]pentanamide |
|---|---|
| PubChem CID | 143988274 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 2,5-diamino-N-[3-phenyl-1-[1-(4-propan-2-ylphenyl)ethenylamino]propyl]pentanamide |
| SMILES | C=C(NC(CCc1ccccc1)NC(=O)C(N)CCCN)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H36N4O/c1-18(2)21-12-14-22(15-13-21)19(3)28-24(16-11-20-8-5-4-6-9-20)29-25(30)23(27)10-7-17-26/h4-6,8-9,12-15,18,23-24,28H,3,7,10-11,16-17,26-27H2,1-2H3,(H,29,30) |
| InChIKey | GGWYIGQQJFNJFE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|