C29H41N5O3 — CID 91278523
N-[1-[[2,8-diamino-5-(2-aminoethyl)-4-oxooct-5-enoyl]amino]-3-phenylpropyl]-4-propan-2-ylbenzamide (PubChem CID 91278523) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[1-[[2,8-diamino-5-(2-aminoethyl)-4-oxooct-5-enoyl]amino]-3-phenylpropyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[1-[[2,8-diamino-5-(2-aminoethyl)-4-oxooct-5-enoyl]amino]-3-phenylpropyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 91278523 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | N-[1-[[2,8-diamino-5-(2-aminoethyl)-4-oxooct-5-enoyl]amino]-3-phenylpropyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NC(CCc2ccccc2)NC(=O)C(N)CC(=O)C(=CCCN)CCN)cc1 |
| InChI | InChI=1S/C29H41N5O3/c1-20(2)22-11-13-24(14-12-22)28(36)33-27(15-10-21-7-4-3-5-8-21)34-29(37)25(32)19-26(35)23(16-18-31)9-6-17-30/h3-5,7-9,11-14,20,25,27H,6,10,15-19,30-32H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | VLIVZSGUAGOFOW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|