C24H33Br2N3O2 — CID 143988836
2-bromo-4-[6-(2-bromo-4-tert-butylanilino)-2,5-dimethylhexan-2-yl]-5-nitroaniline (PubChem CID 143988836) has the molecular formula C24H33Br2N3O2 and a molecular weight of 555.36 g/mol. Its IUPAC name is 2-bromo-4-[6-(2-bromo-4-tert-butylanilino)-2,5-dimethylhexan-2-yl]-5-nitroaniline.
| Compound Name | 2-bromo-4-[6-(2-bromo-4-tert-butylanilino)-2,5-dimethylhexan-2-yl]-5-nitroaniline |
|---|---|
| PubChem CID | 143988836 |
| Molecular Formula | C24H33Br2N3O2 |
| Molecular Weight | 555.36 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | 2-bromo-4-[6-(2-bromo-4-tert-butylanilino)-2,5-dimethylhexan-2-yl]-5-nitroaniline |
| SMILES | CC(CCC(C)(C)c1cc(Br)c(N)cc1[N+](=O)[O-])CNc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C24H33Br2N3O2/c1-15(14-28-21-8-7-16(11-19(21)26)23(2,3)4)9-10-24(5,6)17-12-18(25)20(27)13-22(17)29(30)31/h7-8,11-13,15,28H,9-10,14,27H2,1-6H3 |
| InChIKey | LLMQKXHXHNKXIV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.36 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|