C19H23BrN2O5S — CID 176615696
[(4R)-5-(4-bromo-2-nitroanilino)-4-methylpentyl] 4-methylbenzenesulfonate (PubChem CID 176615696) has the molecular formula C19H23BrN2O5S and a molecular weight of 471.37 g/mol. Its IUPAC name is [(4R)-5-(4-bromo-2-nitroanilino)-4-methylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(4R)-5-(4-bromo-2-nitroanilino)-4-methylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 176615696 |
| Molecular Formula | C19H23BrN2O5S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | [(4R)-5-(4-bromo-2-nitroanilino)-4-methylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@@H](C)CNc2ccc(Br)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23BrN2O5S/c1-14-5-8-17(9-6-14)28(25,26)27-11-3-4-15(2)13-21-18-10-7-16(20)12-19(18)22(23)24/h5-10,12,15,21H,3-4,11,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | XETUFKQVWMSPTC-OAHLLOKOSA-N |
| XLogP | 4.90 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|