C15H21BrN2O5S — CID 176615701
[(4S)-5-(4-bromo-2-nitroanilino)-4-cyclopropylpentyl] methanesulfonate (PubChem CID 176615701) has the molecular formula C15H21BrN2O5S and a molecular weight of 421.31 g/mol. Its IUPAC name is [(4S)-5-(4-bromo-2-nitroanilino)-4-cyclopropylpentyl] methanesulfonate.
| Compound Name | [(4S)-5-(4-bromo-2-nitroanilino)-4-cyclopropylpentyl] methanesulfonate |
|---|---|
| PubChem CID | 176615701 |
| Molecular Formula | C15H21BrN2O5S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | [(4S)-5-(4-bromo-2-nitroanilino)-4-cyclopropylpentyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC[C@H](CNc1ccc(Br)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C15H21BrN2O5S/c1-24(21,22)23-8-2-3-12(11-4-5-11)10-17-14-7-6-13(16)9-15(14)18(19)20/h6-7,9,11-12,17H,2-5,8,10H2,1H3/t12-/m1/s1 |
| InChIKey | ISTYCIKPWDVVCB-GFCCVEGCSA-N |
| XLogP | 3.55 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|