C24H25FN4O5 — CID 143989146
acetylene;5-[4-ethenyl-5-(2-methyliminoethyl)furan-2-yl]imidazolidine-2,4-dione;7-fluoro-6-methoxy-2-methyl-3H-isoindol-1-one (PubChem CID 143989146) has the molecular formula C24H25FN4O5 and a molecular weight of 468.49 g/mol. Its IUPAC name is acetylene;5-[4-ethenyl-5-(2-methyliminoethyl)furan-2-yl]imidazolidine-2,4-dione;7-fluoro-6-methoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | acetylene;5-[4-ethenyl-5-(2-methyliminoethyl)furan-2-yl]imidazolidine-2,4-dione;7-fluoro-6-methoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143989146 |
| Molecular Formula | C24H25FN4O5 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | acetylene;5-[4-ethenyl-5-(2-methyliminoethyl)furan-2-yl]imidazolidine-2,4-dione;7-fluoro-6-methoxy-2-methyl-3H-isoindol-1-one |
| SMILES | C#C.C=Cc1cc(C2NC(=O)NC2=O)oc1C/C=N/C.COc1ccc2c(c1F)C(=O)N(C)C2 |
| InChI | InChI=1S/C12H13N3O3.C10H10FNO2.C2H2/c1-3-7-6-9(18-8(7)4-5-13-2)10-11(16)15-12(17)14-10;1-12-5-6-3-4-7(14-2)9(11)8(6)10(12)13;1-2/h3,5-6,10H,1,4H2,2H3,(H2,14,15,16,17);3-4H,5H2,1-2H3;1-2H/b13-5+;; |
| InChIKey | WCXHLCUEUOEMSU-IXYGCXJQSA-N |
| XLogP | 2.72 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|