C15H17F2N5OS — CID 143991595
(E)-1-(3-amino-12,12-difluoro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-(dimethylamino)but-2-en-1-one (PubChem CID 143991595) has the molecular formula C15H17F2N5OS and a molecular weight of 353.40 g/mol. Its IUPAC name is (E)-1-(3-amino-12,12-difluoro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-(3-amino-12,12-difluoro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 143991595 |
| Molecular Formula | C15H17F2N5OS |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (E)-1-(3-amino-12,12-difluoro-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl)-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1Cc2sc3ncnc(N)c3c2CC1(F)F |
| InChI | InChI=1S/C15H17F2N5OS/c1-21(2)5-3-4-11(23)22-7-10-9(6-15(22,16)17)12-13(18)19-8-20-14(12)24-10/h3-4,8H,5-7H2,1-2H3,(H2,18,19,20)/b4-3+ |
| InChIKey | YMHOUGZBRAPCIO-ONEGZZNKSA-N |
| XLogP | 1.87 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|