C13H22N2 — CID 143993533
1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1,4-diazepane (PubChem CID 143993533) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1,4-diazepane.
| Compound Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 143993533 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1,4-diazepane |
| SMILES | C=C(C)/C=C\C(=C/C)N1CCCNCC1 |
| InChI | InChI=1S/C13H22N2/c1-4-13(7-6-12(2)3)15-10-5-8-14-9-11-15/h4,6-7,14H,2,5,8-11H2,1,3H3/b7-6-,13-4+ |
| InChIKey | MMQOFRFDBKVFQF-UCPAGOOESA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|