C11H24N2O — CID 143994128
3,7-bis(ethylamino)heptan-2-one (PubChem CID 143994128) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 3,7-bis(ethylamino)heptan-2-one.
| Compound Name | 3,7-bis(ethylamino)heptan-2-one |
|---|---|
| PubChem CID | 143994128 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3,7-bis(ethylamino)heptan-2-one |
| SMILES | CCNCCCCC(NCC)C(C)=O |
| InChI | InChI=1S/C11H24N2O/c1-4-12-9-7-6-8-11(10(3)14)13-5-2/h11-13H,4-9H2,1-3H3 |
| InChIKey | QQWURHQXQQFJHB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|