C11H15F3O — CID 143994937
1-tert-butyl-4-(trifluoromethoxy)cyclohexa-1,3-diene (PubChem CID 143994937) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-tert-butyl-4-(trifluoromethoxy)cyclohexa-1,3-diene.
| Compound Name | 1-tert-butyl-4-(trifluoromethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143994937 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-tert-butyl-4-(trifluoromethoxy)cyclohexa-1,3-diene |
| SMILES | CC(C)(C)C1=CC=C(OC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3O/c1-10(2,3)8-4-6-9(7-5-8)15-11(12,13)14/h4,6H,5,7H2,1-3H3 |
| InChIKey | IOMQNZKIYSMXGL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |