C15H26O2 — CID 143996878
(6Z,8E)-6-ethenyl-2-methyldodeca-6,8-diene-1,1-diol (PubChem CID 143996878) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (6Z,8E)-6-ethenyl-2-methyldodeca-6,8-diene-1,1-diol.
| Compound Name | (6Z,8E)-6-ethenyl-2-methyldodeca-6,8-diene-1,1-diol |
|---|---|
| PubChem CID | 143996878 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (6Z,8E)-6-ethenyl-2-methyldodeca-6,8-diene-1,1-diol |
| SMILES | C=C/C(=C\C=C\CCC)CCCC(C)C(O)O |
| InChI | InChI=1S/C15H26O2/c1-4-6-7-8-11-14(5-2)12-9-10-13(3)15(16)17/h5,7-8,11,13,15-17H,2,4,6,9-10,12H2,1,3H3/b8-7+,14-11+ |
| InChIKey | VEENPEKFTGSFBI-DQBULIGTSA-N |
| XLogP | 3.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|