C17H33N3O7 — CID 143996964
2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]ethyl]amino]acetic acid;propan-1-amine (PubChem CID 143996964) has the molecular formula C17H33N3O7 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]ethyl]amino]acetic acid;propan-1-amine.
| Compound Name | 2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]ethyl]amino]acetic acid;propan-1-amine |
|---|---|
| PubChem CID | 143996964 |
| Molecular Formula | C17H33N3O7 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]ethyl]amino]acetic acid;propan-1-amine |
| SMILES | CCCCCC(=O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O.CCCN |
| InChI | InChI=1S/C14H24N2O7.C3H9N/c1-2-3-4-5-11(17)16(10-14(22)23)7-6-15(8-12(18)19)9-13(20)21;1-2-3-4/h2-10H2,1H3,(H,18,19)(H,20,21)(H,22,23);2-4H2,1H3 |
| InChIKey | WWQHKQKJDJADRZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|