About ethane;2-(4-oxopentyl)guanidine
ethane;2-(4-oxopentyl)guanidine (PubChem CID 143997216) has the molecular formula C8H19N3O
and a molecular weight of 173.26 g/mol. Its IUPAC name is ethane;2-(4-oxopentyl)guanidine.
Molecular Properties
| Compound Name | ethane;2-(4-oxopentyl)guanidine |
| PubChem CID | 143997216 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | ethane;2-(4-oxopentyl)guanidine |
| SMILES | CC.CC(=O)CCCN=C(N)N |
| InChI | InChI=1S/C6H13N3O.C2H6/c1-5(10)3-2-4-9-6(7)8;1-2/h2-4H2,1H3,(H4,7,8,9);1-2H3 |
| InChIKey | UMVGCWPHBPQSAW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(4-oxopentyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-oxopentyl)guanidine?
The IUPAC name of ethane;2-(4-oxopentyl)guanidine (CID 143997216) is ethane;2-(4-oxopentyl)guanidine.
What is the SMILES notation for ethane;2-(4-oxopentyl)guanidine?
The canonical SMILES for ethane;2-(4-oxopentyl)guanidine is CC.CC(=O)CCCN=C(N)N.
What is the InChIKey of ethane;2-(4-oxopentyl)guanidine?
The InChIKey is UMVGCWPHBPQSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O.C2H6/c1-5(10)3-2-4-9-6(7)8;1-2/h2-4H2,1H3,(H4,7,8,9);1-2H3.
What are the key properties of ethane;2-(4-oxopentyl)guanidine?
ethane;2-(4-oxopentyl)guanidine has a molecular weight of 173.26 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-oxopentyl)guanidine is sourced from PubChem (CID 143997216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).