C22H37ClN4O — CID 143997705
1-[(4-chloro-3-methylphenyl)methylamino]-1-(ethylamino)ethanol;ethane;N,N,6-trimethylpyridin-2-amine (PubChem CID 143997705) has the molecular formula C22H37ClN4O and a molecular weight of 409.02 g/mol. Its IUPAC name is 1-[(4-chloro-3-methylphenyl)methylamino]-1-(ethylamino)ethanol;ethane;N,N,6-trimethylpyridin-2-amine.
| Compound Name | 1-[(4-chloro-3-methylphenyl)methylamino]-1-(ethylamino)ethanol;ethane;N,N,6-trimethylpyridin-2-amine |
|---|---|
| PubChem CID | 143997705 |
| Molecular Formula | C22H37ClN4O |
| Molecular Weight | 409.02 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 1-[(4-chloro-3-methylphenyl)methylamino]-1-(ethylamino)ethanol;ethane;N,N,6-trimethylpyridin-2-amine |
| SMILES | CC.CCNC(C)(O)NCc1ccc(Cl)c(C)c1.Cc1cccc(N(C)C)n1 |
| InChI | InChI=1S/C12H19ClN2O.C8H12N2.C2H6/c1-4-14-12(3,16)15-8-10-5-6-11(13)9(2)7-10;1-7-5-4-6-8(9-7)10(2)3;1-2/h5-7,14-16H,4,8H2,1-3H3;4-6H,1-3H3;1-2H3 |
| InChIKey | KSZGVAURHQOWKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.02 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|