C19H23F3O — CID 143998609
ethane;1,7,8-trifluoro-6-(4-methylcyclohexyl)naphthalen-2-ol (PubChem CID 143998609) has the molecular formula C19H23F3O and a molecular weight of 324.39 g/mol. Its IUPAC name is ethane;1,7,8-trifluoro-6-(4-methylcyclohexyl)naphthalen-2-ol.
| Compound Name | ethane;1,7,8-trifluoro-6-(4-methylcyclohexyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 143998609 |
| Molecular Formula | C19H23F3O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | ethane;1,7,8-trifluoro-6-(4-methylcyclohexyl)naphthalen-2-ol |
| SMILES | CC.CC1CCC(c2cc3ccc(O)c(F)c3c(F)c2F)CC1 |
| InChI | InChI=1S/C17H17F3O.C2H6/c1-9-2-4-10(5-3-9)12-8-11-6-7-13(21)16(19)14(11)17(20)15(12)18;1-2/h6-10,21H,2-5H2,1H3;1-2H3 |
| InChIKey | IJMRTBYQGFLCNX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |