C13H20N2O — CID 158163153
2,3-diamino-4-(4-methylcyclohexyl)phenol (PubChem CID 158163153) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2,3-diamino-4-(4-methylcyclohexyl)phenol.
| Compound Name | 2,3-diamino-4-(4-methylcyclohexyl)phenol |
|---|---|
| PubChem CID | 158163153 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2,3-diamino-4-(4-methylcyclohexyl)phenol |
| SMILES | CC1CCC(c2ccc(O)c(N)c2N)CC1 |
| InChI | InChI=1S/C13H20N2O/c1-8-2-4-9(5-3-8)10-6-7-11(16)13(15)12(10)14/h6-9,16H,2-5,14-15H2,1H3 |
| InChIKey | FWNGTOVRYUJFAR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|