C24H29F2N7O4 — CID 143999527
3-[3,5-difluoro-4-[4-[(E)-4-(2-iminopyrimidin-1-yl)but-3-enoyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;formamide (PubChem CID 143999527) has the molecular formula C24H29F2N7O4 and a molecular weight of 517.54 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[4-[(E)-4-(2-iminopyrimidin-1-yl)but-3-enoyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;formamide.
| Compound Name | 3-[3,5-difluoro-4-[4-[(E)-4-(2-iminopyrimidin-1-yl)but-3-enoyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;formamide |
|---|---|
| PubChem CID | 143999527 |
| Molecular Formula | C24H29F2N7O4 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 3-[3,5-difluoro-4-[4-[(E)-4-(2-iminopyrimidin-1-yl)but-3-enoyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;formamide |
| SMILES | NC=O.[H]/N=c1\ncccn1/C=C/CC(=O)N1CCN(c2c(F)cc(N3CC(CC)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C23H26F2N6O3.CH3NO/c1-2-17-15-31(23(33)34-17)16-13-18(24)21(19(25)14-16)29-11-9-28(10-12-29)20(32)5-3-7-30-8-4-6-27-22(30)26;2-1-3/h3-4,6-8,13-14,17,26H,2,5,9-12,15H2,1H3;1H,(H2,2,3)/b7-3+,26-22+; |
| InChIKey | YNZDODFJKSXQGT-VKRYCYBMSA-N |
| XLogP | 1.69 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|