C25H32ClN3OS — CID 1440488
2-[5-(4-chlorophenyl)-1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanyl-1-[(3S)-3-methylpiperidin-1-yl]ethanone (PubChem CID 1440488) has the molecular formula C25H32ClN3OS and a molecular weight of 458.07 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanyl-1-[(3S)-3-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-[5-(4-chlorophenyl)-1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanyl-1-[(3S)-3-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 1440488 |
| Molecular Formula | C25H32ClN3OS |
| Molecular Weight | 458.07 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-[2-(cyclohexen-1-yl)ethyl]imidazol-2-yl]sulfanyl-1-[(3S)-3-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@H]1CCCN(C(=O)CSc2ncc(-c3ccc(Cl)cc3)n2CCC2=CCCCC2)C1 |
| InChI | InChI=1S/C25H32ClN3OS/c1-19-6-5-14-28(17-19)24(30)18-31-25-27-16-23(21-9-11-22(26)12-10-21)29(25)15-13-20-7-3-2-4-8-20/h7,9-12,16,19H,2-6,8,13-15,17-18H2,1H3/t19-/m0/s1 |
| InChIKey | VJLHAUYSMNLMRC-IBGZPJMESA-N |
| XLogP | 6.44 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.07 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|