C10H20N2O5 — CID 14406339
(2S)-2,5-diaminopentanoic acid;3-methyl-2-oxobutanoic acid (PubChem CID 14406339) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2S)-2,5-diaminopentanoic acid;3-methyl-2-oxobutanoic acid.
| Compound Name | (2S)-2,5-diaminopentanoic acid;3-methyl-2-oxobutanoic acid |
|---|---|
| PubChem CID | 14406339 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2S)-2,5-diaminopentanoic acid;3-methyl-2-oxobutanoic acid |
| SMILES | CC(C)C(=O)C(=O)O.NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.C5H8O3/c6-3-1-2-4(7)5(8)9;1-3(2)4(6)5(7)8/h4H,1-3,6-7H2,(H,8,9);3H,1-2H3,(H,7,8)/t4-;/m0./s1 |
| InChIKey | IUQCXXQQMQULHI-WCCKRBBISA-N |
| XLogP | -0.57 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|