C19H26O6 — CID 14411242
(3'aR,4S,7'R,7'aR)-2,2,2',2'-tetramethyl-7'-phenylmethoxyspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] (PubChem CID 14411242) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (3'aR,4S,7'R,7'aR)-2,2,2',2'-tetramethyl-7'-phenylmethoxyspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran].
| Compound Name | (3'aR,4S,7'R,7'aR)-2,2,2',2'-tetramethyl-7'-phenylmethoxyspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] |
|---|---|
| PubChem CID | 14411242 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3'aR,4S,7'R,7'aR)-2,2,2',2'-tetramethyl-7'-phenylmethoxyspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] |
| SMILES | CC1(C)O[C@H]2[C@@H](OCc3ccccc3)[C@@]3(COC(C)(C)O3)OC[C@H]2O1 |
| InChI | InChI=1S/C19H26O6/c1-17(2)22-12-19(25-17)16(20-10-13-8-6-5-7-9-13)15-14(11-21-19)23-18(3,4)24-15/h5-9,14-16H,10-12H2,1-4H3/t14-,15-,16-,19+/m1/s1 |
| InChIKey | GBZJQFJFEFKLCF-NNFUDEMPSA-N |
| XLogP | 2.60 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |