C24H26N2O5S — CID 1441376
N-[2,5-diethoxy-4-[(2-thiophen-2-ylacetyl)amino]phenyl]-4-methoxybenzamide (PubChem CID 1441376) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[(2-thiophen-2-ylacetyl)amino]phenyl]-4-methoxybenzamide.
| Compound Name | N-[2,5-diethoxy-4-[(2-thiophen-2-ylacetyl)amino]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 1441376 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[2,5-diethoxy-4-[(2-thiophen-2-ylacetyl)amino]phenyl]-4-methoxybenzamide |
| SMILES | CCOc1cc(NC(=O)c2ccc(OC)cc2)c(OCC)cc1NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C24H26N2O5S/c1-4-30-21-15-20(26-24(28)16-8-10-17(29-3)11-9-16)22(31-5-2)14-19(21)25-23(27)13-18-7-6-12-32-18/h6-12,14-15H,4-5,13H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | HDXRDCLLMYBVPL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |