About (E)-6-azidonon-4-ene
(E)-6-azidonon-4-ene (PubChem CID 14415581) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is (E)-6-azidonon-4-ene.
Molecular Properties
| Compound Name | (E)-6-azidonon-4-ene |
| PubChem CID | 14415581 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (E)-6-azidonon-4-ene |
| SMILES | CCC/C=C/C(CCC)N=[N+]=[N-] |
| InChI | InChI=1S/C9H17N3/c1-3-5-6-8-9(7-4-2)11-12-10/h6,8-9H,3-5,7H2,1-2H3/b8-6+ |
| InChIKey | GJLRMRNHUZKKJT-SOFGYWHQSA-N |
| XLogP | 3.82 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-azidonon-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-azidonon-4-ene?
The IUPAC name of (E)-6-azidonon-4-ene (CID 14415581) is (E)-6-azidonon-4-ene.
What is the SMILES notation for (E)-6-azidonon-4-ene?
The canonical SMILES for (E)-6-azidonon-4-ene is CCC/C=C/C(CCC)N=[N+]=[N-].
What is the InChIKey of (E)-6-azidonon-4-ene?
The InChIKey is GJLRMRNHUZKKJT-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H17N3/c1-3-5-6-8-9(7-4-2)11-12-10/h6,8-9H,3-5,7H2,1-2H3/b8-6+.
What are the key properties of (E)-6-azidonon-4-ene?
(E)-6-azidonon-4-ene has a molecular weight of 167.26 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-azidonon-4-ene is sourced from PubChem (CID 14415581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).