About 2,3-diaminobutanedinitrile
2,3-diaminobutanedinitrile (PubChem CID 14416612) has the molecular formula C4H6N4
and a molecular weight of 110.12 g/mol. Its IUPAC name is 2,3-diaminobutanedinitrile.
Molecular Properties
| Compound Name | 2,3-diaminobutanedinitrile |
| PubChem CID | 14416612 |
| Molecular Formula | C4H6N4 |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | 2,3-diaminobutanedinitrile |
| SMILES | N#CC(N)C(N)C#N |
| InChI | InChI=1S/C4H6N4/c5-1-3(7)4(8)2-6/h3-4H,7-8H2 |
| InChIKey | XBXQRUBOMCRRTA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-diaminobutanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminobutanedinitrile?
The IUPAC name of 2,3-diaminobutanedinitrile (CID 14416612) is 2,3-diaminobutanedinitrile.
What is the SMILES notation for 2,3-diaminobutanedinitrile?
The canonical SMILES for 2,3-diaminobutanedinitrile is N#CC(N)C(N)C#N.
What is the InChIKey of 2,3-diaminobutanedinitrile?
The InChIKey is XBXQRUBOMCRRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4/c5-1-3(7)4(8)2-6/h3-4H,7-8H2.
What are the key properties of 2,3-diaminobutanedinitrile?
2,3-diaminobutanedinitrile has a molecular weight of 110.12 g/mol, XLogP of -1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminobutanedinitrile is sourced from PubChem (CID 14416612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).