C14H10FNOS — CID 14424348
2-(4-fluorophenyl)-5-(3-methylthiophen-2-yl)-1,3-oxazole (PubChem CID 14424348) has the molecular formula C14H10FNOS and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(3-methylthiophen-2-yl)-1,3-oxazole.
| Compound Name | 2-(4-fluorophenyl)-5-(3-methylthiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 14424348 |
| Molecular Formula | C14H10FNOS |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(3-methylthiophen-2-yl)-1,3-oxazole |
| SMILES | Cc1ccsc1-c1cnc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C14H10FNOS/c1-9-6-7-18-13(9)12-8-16-14(17-12)10-2-4-11(15)5-3-10/h2-8H,1H3 |
| InChIKey | SFBPZYBKHYQKFG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |