C15H11FN2O — CID 86217587
5-(4-fluorophenyl)-2-(4-methyl-3-pyridinyl)-1,3-oxazole (PubChem CID 86217587) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-(4-methyl-3-pyridinyl)-1,3-oxazole.
| Compound Name | 5-(4-fluorophenyl)-2-(4-methyl-3-pyridinyl)-1,3-oxazole |
|---|---|
| PubChem CID | 86217587 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(4-fluorophenyl)-2-(4-methyl-3-pyridinyl)-1,3-oxazole |
| SMILES | Cc1ccncc1-c1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H11FN2O/c1-10-6-7-17-8-13(10)15-18-9-14(19-15)11-2-4-12(16)5-3-11/h2-9H,1H3 |
| InChIKey | CUQVOKBJUCXPIX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |